C29H27N5O4 — CID 169268142
2-N-(2,6-dimethoxyphenyl)-6-N-(8-pyrimidin-5-yl-1,2,3,4-tetrahydronaphthalen-2-yl)pyridine-2,6-dicarboxamide (PubChem CID 169268142) has the molecular formula C29H27N5O4 and a molecular weight of 509.57 g/mol. Its IUPAC name is 2-N-(2,6-dimethoxyphenyl)-6-N-(8-pyrimidin-5-yl-1,2,3,4-tetrahydronaphthalen-2-yl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-(2,6-dimethoxyphenyl)-6-N-(8-pyrimidin-5-yl-1,2,3,4-tetrahydronaphthalen-2-yl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 169268142 |
| Molecular Formula | C29H27N5O4 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 2-N-(2,6-dimethoxyphenyl)-6-N-(8-pyrimidin-5-yl-1,2,3,4-tetrahydronaphthalen-2-yl)pyridine-2,6-dicarboxamide |
| SMILES | COc1cccc(OC)c1NC(=O)c1cccc(C(=O)NC2CCc3cccc(-c4cncnc4)c3C2)n1 |
| InChI | InChI=1S/C29H27N5O4/c1-37-25-10-5-11-26(38-2)27(25)34-29(36)24-9-4-8-23(33-24)28(35)32-20-13-12-18-6-3-7-21(22(18)14-20)19-15-30-17-31-16-19/h3-11,15-17,20H,12-14H2,1-2H3,(H,32,35)(H,34,36) |
| InChIKey | WAYCMOKVAMIJPN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |