C11H16ClN3O2 — CID 169269119
[[C-(6-chloro-3-methyl-2-pyridinyl)-N-methylcarbonimidoyl]amino] formate;ethane (PubChem CID 169269119) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is [[C-(6-chloro-3-methyl-2-pyridinyl)-N-methylcarbonimidoyl]amino] formate;ethane.
| Compound Name | [[C-(6-chloro-3-methyl-2-pyridinyl)-N-methylcarbonimidoyl]amino] formate;ethane |
|---|---|
| PubChem CID | 169269119 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | [[C-(6-chloro-3-methyl-2-pyridinyl)-N-methylcarbonimidoyl]amino] formate;ethane |
| SMILES | C/N=C(\NOC=O)c1nc(Cl)ccc1C.CC |
| InChI | InChI=1S/C9H10ClN3O2.C2H6/c1-6-3-4-7(10)12-8(6)9(11-2)13-15-5-14;1-2/h3-5H,1-2H3,(H,11,13);1-2H3 |
| InChIKey | PLYXVCMRFAJGQO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|