C10H10ClN3O4 — CID 89404313
methyl 3-[(3-carbamoyl-6-chloro-2-pyridinyl)amino]-3-oxopropanoate (PubChem CID 89404313) has the molecular formula C10H10ClN3O4 and a molecular weight of 271.66 g/mol. Its IUPAC name is methyl 3-[(3-carbamoyl-6-chloro-2-pyridinyl)amino]-3-oxopropanoate.
| Compound Name | methyl 3-[(3-carbamoyl-6-chloro-2-pyridinyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 89404313 |
| Molecular Formula | C10H10ClN3O4 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | methyl 3-[(3-carbamoyl-6-chloro-2-pyridinyl)amino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1nc(Cl)ccc1C(N)=O |
| InChI | InChI=1S/C10H10ClN3O4/c1-18-8(16)4-7(15)14-10-5(9(12)17)2-3-6(11)13-10/h2-3H,4H2,1H3,(H2,12,17)(H,13,14,15) |
| InChIKey | RYPXEOACGOFQNB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|