C13H17ClN4O4 — CID 130447989
methyl 4-[(3-amino-6-chloro-2-pyridinyl)amino]-4-oxo-3-(propanoylamino)butanoate (PubChem CID 130447989) has the molecular formula C13H17ClN4O4 and a molecular weight of 328.76 g/mol. Its IUPAC name is methyl 4-[(3-amino-6-chloro-2-pyridinyl)amino]-4-oxo-3-(propanoylamino)butanoate.
| Compound Name | methyl 4-[(3-amino-6-chloro-2-pyridinyl)amino]-4-oxo-3-(propanoylamino)butanoate |
|---|---|
| PubChem CID | 130447989 |
| Molecular Formula | C13H17ClN4O4 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | methyl 4-[(3-amino-6-chloro-2-pyridinyl)amino]-4-oxo-3-(propanoylamino)butanoate |
| SMILES | CCC(=O)NC(CC(=O)OC)C(=O)Nc1nc(Cl)ccc1N |
| InChI | InChI=1S/C13H17ClN4O4/c1-3-10(19)16-8(6-11(20)22-2)13(21)18-12-7(15)4-5-9(14)17-12/h4-5,8H,3,6,15H2,1-2H3,(H,16,19)(H,17,18,21) |
| InChIKey | JKJYJMPATJZUIX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|