C21H23N3O4 — CID 16926964
N-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-2-methyl-3-nitrobenzamide (PubChem CID 16926964) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-2-methyl-3-nitrobenzamide.
| Compound Name | N-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 16926964 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-2-methyl-3-nitrobenzamide |
| SMILES | CCCCN1C(=O)CCc2cc(NC(=O)c3cccc([N+](=O)[O-])c3C)ccc21 |
| InChI | InChI=1S/C21H23N3O4/c1-3-4-12-23-19-10-9-16(13-15(19)8-11-20(23)25)22-21(26)17-6-5-7-18(14(17)2)24(27)28/h5-7,9-10,13H,3-4,8,11-12H2,1-2H3,(H,22,26) |
| InChIKey | NEXNKCPXRINEBT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|