C27H19ClN6O5 — CID 169269887
(Z)-2-[8-[(1R)-1-[[6-chloro-2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-3-pyridinyl]amino]ethyl]-6-methyl-4-oxo-2-pyridin-3-ylchromen-3-yl]-3-hydroxyprop-2-enenitrile (PubChem CID 169269887) has the molecular formula C27H19ClN6O5 and a molecular weight of 542.94 g/mol. Its IUPAC name is (Z)-2-[8-[(1R)-1-[[6-chloro-2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-3-pyridinyl]amino]ethyl]-6-methyl-4-oxo-2-pyridin-3-ylchromen-3-yl]-3-hydroxyprop-2-enenitrile.
| Compound Name | (Z)-2-[8-[(1R)-1-[[6-chloro-2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-3-pyridinyl]amino]ethyl]-6-methyl-4-oxo-2-pyridin-3-ylchromen-3-yl]-3-hydroxyprop-2-enenitrile |
|---|---|
| PubChem CID | 169269887 |
| Molecular Formula | C27H19ClN6O5 |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | (Z)-2-[8-[(1R)-1-[[6-chloro-2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-3-pyridinyl]amino]ethyl]-6-methyl-4-oxo-2-pyridin-3-ylchromen-3-yl]-3-hydroxyprop-2-enenitrile |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2-c2noc(=O)[nH]2)c2oc(-c3cccnc3)c(/C(C#N)=C/O)c(=O)c2c1 |
| InChI | InChI=1S/C27H19ClN6O5/c1-13-8-17(14(2)31-19-5-6-20(28)32-22(19)26-33-27(37)39-34-26)25-18(9-13)23(36)21(16(10-29)12-35)24(38-25)15-4-3-7-30-11-15/h3-9,11-12,14,31,35H,1-2H3,(H,33,34,37)/b16-12+/t14-/m1/s1 |
| InChIKey | UVOBZMVVSSWUCA-RGHBXIHOSA-N |
| XLogP | 5.15 |
| TPSA | 170.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|