C36H47N5O2Si — CID 169273646
6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(4-methoxyphenyl)methyl]-7,8,9,10,11,12-hexahydro-5H-pyrimido[4,5-b][1,5]diazecin-4-amine (PubChem CID 169273646) has the molecular formula C36H47N5O2Si and a molecular weight of 609.89 g/mol. Its IUPAC name is 6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(4-methoxyphenyl)methyl]-7,8,9,10,11,12-hexahydro-5H-pyrimido[4,5-b][1,5]diazecin-4-amine.
| Compound Name | 6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(4-methoxyphenyl)methyl]-7,8,9,10,11,12-hexahydro-5H-pyrimido[4,5-b][1,5]diazecin-4-amine |
|---|---|
| PubChem CID | 169273646 |
| Molecular Formula | C36H47N5O2Si |
| Molecular Weight | 609.89 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | 6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(4-methoxyphenyl)methyl]-7,8,9,10,11,12-hexahydro-5H-pyrimido[4,5-b][1,5]diazecin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3c2CN(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCCCCN3)cc1 |
| InChI | InChI=1S/C36H47N5O2Si/c1-36(2,3)44(31-14-8-5-9-15-31,32-16-10-6-11-17-32)43-25-24-41-23-13-7-12-22-37-34-33(27-41)35(40-28-39-34)38-26-29-18-20-30(42-4)21-19-29/h5-6,8-11,14-21,28H,7,12-13,22-27H2,1-4H3,(H2,37,38,39,40) |
| InChIKey | ZPCVGGMHQLFCHY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.89 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|