C36H46N5O2Si+ — CID 169273659
9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(4-methoxyphenyl)methyl]-1,3,5-triaza-9-azoniatricyclo[7.5.0.02,7]tetradeca-2,4,6-trien-6-amine (PubChem CID 169273659) has the molecular formula C36H46N5O2Si+ and a molecular weight of 608.88 g/mol. Its IUPAC name is 9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(4-methoxyphenyl)methyl]-1,3,5-triaza-9-azoniatricyclo[7.5.0.02,7]tetradeca-2,4,6-trien-6-amine.
| Compound Name | 9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(4-methoxyphenyl)methyl]-1,3,5-triaza-9-azoniatricyclo[7.5.0.02,7]tetradeca-2,4,6-trien-6-amine |
|---|---|
| PubChem CID | 169273659 |
| Molecular Formula | C36H46N5O2Si+ |
| Molecular Weight | 608.88 g/mol |
| Exact Mass | 608.34 |
| IUPAC Name | 9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(4-methoxyphenyl)methyl]-1,3,5-triaza-9-azoniatricyclo[7.5.0.02,7]tetradeca-2,4,6-trien-6-amine |
| SMILES | COc1ccc(CNc2ncnc3c2C[N+]2(CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)CCCCCN32)cc1 |
| InChI | InChI=1S/C36H46N5O2Si/c1-36(2,3)44(31-14-8-5-9-15-31,32-16-10-6-11-17-32)43-25-24-41-23-13-7-12-22-40(41)35-33(27-41)34(38-28-39-35)37-26-29-18-20-30(42-4)21-19-29/h5-6,8-11,14-21,28H,7,12-13,22-27H2,1-4H3,(H,37,38,39)/q+1 |
| InChIKey | GRTRVRURGWGABW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.88 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|