C20H25FN4O6S — CID 169274371
tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1,4-trioxo-3,5-dihydro-2H-1λ6,5-benzothiazepin-3-yl]carbamate (PubChem CID 169274371) has the molecular formula C20H25FN4O6S and a molecular weight of 468.51 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1,4-trioxo-3,5-dihydro-2H-1λ6,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1,4-trioxo-3,5-dihydro-2H-1λ6,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 169274371 |
| Molecular Formula | C20H25FN4O6S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1,4-trioxo-3,5-dihydro-2H-1λ6,5-benzothiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CS(=O)(=O)c2cc(F)c(-c3nnc(C(C)(C)C)o3)cc2NC1=O |
| InChI | InChI=1S/C20H25FN4O6S/c1-19(2,3)17-25-24-16(30-17)10-7-12-14(8-11(10)21)32(28,29)9-13(15(26)22-12)23-18(27)31-20(4,5)6/h7-8,13H,9H2,1-6H3,(H,22,26)(H,23,27)/t13-/m0/s1 |
| InChIKey | RABGIHWOOMXCMJ-ZDUSSCGKSA-N |
| XLogP | 2.79 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |