C23H23FN6O2S — CID 169279500
5-[(2S,13R,14R)-10-fluoro-12-methylsulfonyl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraen-13-yl]-1H-indazol-3-amine (PubChem CID 169279500) has the molecular formula C23H23FN6O2S and a molecular weight of 466.54 g/mol. Its IUPAC name is 5-[(2S,13R,14R)-10-fluoro-12-methylsulfonyl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraen-13-yl]-1H-indazol-3-amine.
| Compound Name | 5-[(2S,13R,14R)-10-fluoro-12-methylsulfonyl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraen-13-yl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 169279500 |
| Molecular Formula | C23H23FN6O2S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 5-[(2S,13R,14R)-10-fluoro-12-methylsulfonyl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraen-13-yl]-1H-indazol-3-amine |
| SMILES | CS(=O)(=O)N1c2c(F)cc3[nH]ncc3c2[C@H]2C3CCC(C3)[C@H]2[C@@H]1c1ccc2[nH]nc(N)c2c1 |
| InChI | InChI=1S/C23H23FN6O2S/c1-33(31,32)30-21(12-4-5-16-13(7-12)23(25)29-28-16)19-11-3-2-10(6-11)18(19)20-14-9-26-27-17(14)8-15(24)22(20)30/h4-5,7-11,18-19,21H,2-3,6H2,1H3,(H,26,27)(H3,25,28,29)/t10?,11?,18-,19+,21-/m0/s1 |
| InChIKey | PNZDDXGAJVDKLT-OQUGKTIRSA-N |
| XLogP | 3.81 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |