C23H24N6 — CID 169279424
1-methyl-5-[(1R,2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]indazol-3-amine (PubChem CID 169279424) has the molecular formula C23H24N6 and a molecular weight of 384.49 g/mol. Its IUPAC name is 1-methyl-5-[(1R,2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]indazol-3-amine.
| Compound Name | 1-methyl-5-[(1R,2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]indazol-3-amine |
|---|---|
| PubChem CID | 169279424 |
| Molecular Formula | C23H24N6 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-methyl-5-[(1R,2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]indazol-3-amine |
| SMILES | Cn1nc(N)c2cc([C@@H]3Nc4ccc5[nH]ncc5c4[C@H]4[C@@H]5CCC(C5)[C@H]43)ccc21 |
| InChI | InChI=1S/C23H24N6/c1-29-18-7-4-13(9-14(18)23(24)28-29)22-20-12-3-2-11(8-12)19(20)21-15-10-25-27-16(15)5-6-17(21)26-22/h4-7,9-12,19-20,22,26H,2-3,8H2,1H3,(H2,24,28)(H,25,27)/t11-,12?,19+,20-,22+/m1/s1 |
| InChIKey | MHCNCPVEXWIYQD-ZOYBEJBFSA-N |
| XLogP | 4.33 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |