C19H19N3S — CID 169279463
13-thiophen-2-yl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene (PubChem CID 169279463) has the molecular formula C19H19N3S and a molecular weight of 321.45 g/mol. Its IUPAC name is 13-thiophen-2-yl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene.
| Compound Name | 13-thiophen-2-yl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene |
|---|---|
| PubChem CID | 169279463 |
| Molecular Formula | C19H19N3S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 13-thiophen-2-yl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene |
| SMILES | c1csc(C2Nc3ccc4[nH]ncc4c3C3C4CCC(C4)C23)c1 |
| InChI | InChI=1S/C19H19N3S/c1-2-15(23-7-1)19-17-11-4-3-10(8-11)16(17)18-12-9-20-22-13(12)5-6-14(18)21-19/h1-2,5-7,9-11,16-17,19,21H,3-4,8H2,(H,20,22) |
| InChIKey | QVAQREHAAXADRM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |