C22H21N5 — CID 169279581
13-(1H-indazol-5-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene (PubChem CID 169279581) has the molecular formula C22H21N5 and a molecular weight of 355.44 g/mol. Its IUPAC name is 13-(1H-indazol-5-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene.
| Compound Name | 13-(1H-indazol-5-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene |
|---|---|
| PubChem CID | 169279581 |
| Molecular Formula | C22H21N5 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 13-(1H-indazol-5-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene |
| SMILES | c1cc2[nH]ncc2cc1C1Nc2ccc3[nH]ncc3c2C2C3CCC(C3)C12 |
| InChI | InChI=1S/C22H21N5/c1-2-12-7-11(1)19-20(12)22(13-3-4-16-14(8-13)9-23-26-16)25-18-6-5-17-15(21(18)19)10-24-27-17/h3-6,8-12,19-20,22,25H,1-2,7H2,(H,23,26)(H,24,27) |
| InChIKey | MQLGUBQMZIQVKG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |