C22H20N4S — CID 169279607
6-[(2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-1,3-benzothiazole (PubChem CID 169279607) has the molecular formula C22H20N4S and a molecular weight of 372.50 g/mol. Its IUPAC name is 6-[(2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-1,3-benzothiazole.
| Compound Name | 6-[(2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 169279607 |
| Molecular Formula | C22H20N4S |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 6-[(2S,13R,14R)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-1,3-benzothiazole |
| SMILES | c1nc2ccc([C@@H]3Nc4ccc5[nH]ncc5c4[C@H]4C5CCC(C5)[C@@H]34)cc2s1 |
| InChI | InChI=1S/C22H20N4S/c1-2-12-7-11(1)19-20(12)22(13-3-4-16-18(8-13)27-10-23-16)25-17-6-5-15-14(21(17)19)9-24-26-15/h3-6,8-12,19-20,22,25H,1-2,7H2,(H,24,26)/t11?,12?,19-,20+,22-/m0/s1 |
| InChIKey | LBCPGZWROMGHPC-MDUYRWAASA-N |
| XLogP | 5.47 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |