C34H30I5O6- — CID 169283589
2-[4-[4-[4-[2,5-diiodo-4-(oxan-2-yloxy)phenoxy]phenyl]iodanuidylphenoxy]-2,5-diiodophenoxy]oxane (PubChem CID 169283589) has the molecular formula C34H30I5O6- and a molecular weight of 1169.13 g/mol. Its IUPAC name is 2-[4-[4-[4-[2,5-diiodo-4-(oxan-2-yloxy)phenoxy]phenyl]iodanuidylphenoxy]-2,5-diiodophenoxy]oxane.
| Compound Name | 2-[4-[4-[4-[2,5-diiodo-4-(oxan-2-yloxy)phenoxy]phenyl]iodanuidylphenoxy]-2,5-diiodophenoxy]oxane |
|---|---|
| PubChem CID | 169283589 |
| Molecular Formula | C34H30I5O6- |
| Molecular Weight | 1169.13 g/mol |
| Exact Mass | 1168.73 |
| IUPAC Name | 2-[4-[4-[4-[2,5-diiodo-4-(oxan-2-yloxy)phenoxy]phenyl]iodanuidylphenoxy]-2,5-diiodophenoxy]oxane |
| SMILES | Ic1cc(OC2CCCCO2)c(I)cc1Oc1ccc([I-]c2ccc(Oc3cc(I)c(OC4CCCCO4)cc3I)cc2)cc1 |
| InChI | InChI=1S/C34H30I5O6/c35-25-19-31(44-33-5-1-3-15-40-33)27(37)17-29(25)42-23-11-7-21(8-12-23)39-22-9-13-24(14-10-22)43-30-18-28(38)32(20-26(30)36)45-34-6-2-4-16-41-34/h7-14,17-20,33-34H,1-6,15-16H2/q-1 |
| InChIKey | RIPDQEXGIRNPIR-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1169.13 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|