C36H20Cl4FN — CID 169284801
3,6-bis(3,5-dichlorophenyl)-9-[2-(2-fluorophenyl)phenyl]carbazole (PubChem CID 169284801) has the molecular formula C36H20Cl4FN and a molecular weight of 627.37 g/mol. Its IUPAC name is 3,6-bis(3,5-dichlorophenyl)-9-[2-(2-fluorophenyl)phenyl]carbazole.
| Compound Name | 3,6-bis(3,5-dichlorophenyl)-9-[2-(2-fluorophenyl)phenyl]carbazole |
|---|---|
| PubChem CID | 169284801 |
| Molecular Formula | C36H20Cl4FN |
| Molecular Weight | 627.37 g/mol |
| Exact Mass | 625.03 |
| IUPAC Name | 3,6-bis(3,5-dichlorophenyl)-9-[2-(2-fluorophenyl)phenyl]carbazole |
| SMILES | Fc1ccccc1-c1ccccc1-n1c2ccc(-c3cc(Cl)cc(Cl)c3)cc2c2cc(-c3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C36H20Cl4FN/c37-25-13-23(14-26(38)19-25)21-9-11-35-31(17-21)32-18-22(24-15-27(39)20-28(40)16-24)10-12-36(32)42(35)34-8-4-2-6-30(34)29-5-1-3-7-33(29)41/h1-20H |
| InChIKey | ZRIWUYGDNYMBIJ-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.37 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |