C28H50O3Si — CID 169292531
(3R,5R,8R,9R,10S,13S,14S,17S)-17-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-13-methyl-3-(oxiran-2-yl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169292531) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S,17S)-17-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-13-methyl-3-(oxiran-2-yl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S,17S)-17-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-13-methyl-3-(oxiran-2-yl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169292531 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S,17S)-17-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-13-methyl-3-(oxiran-2-yl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@](O)(C5CO5)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H50O3Si/c1-18(31-32(6,7)26(2,3)4)23-10-11-24-22-9-8-19-16-28(29,25-17-30-25)15-13-20(19)21(22)12-14-27(23,24)5/h18-25,29H,8-17H2,1-7H3/t18?,19-,20+,21-,22-,23-,24+,25?,27-,28-/m1/s1 |
| InChIKey | VIWQDDKDWJJRHQ-XGGCFPNXSA-N |
| XLogP | 6.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|