C35H27BN2O — CID 169293259
11-tert-butyl-15-(2,3,4,5,6-pentadeuteriophenyl)-1,15-diaza-8-boraheptacyclo[14.10.2.02,7.08,28.09,14.019,27.020,25]octacosa-2,4,6,9(14),10,12,16(28),17,19(27),20,22,24-dodecaen-26-one (PubChem CID 169293259) has the molecular formula C35H27BN2O and a molecular weight of 507.46 g/mol. Its IUPAC name is 11-tert-butyl-15-(2,3,4,5,6-pentadeuteriophenyl)-1,15-diaza-8-boraheptacyclo[14.10.2.02,7.08,28.09,14.019,27.020,25]octacosa-2,4,6,9(14),10,12,16(28),17,19(27),20,22,24-dodecaen-26-one.
| Compound Name | 11-tert-butyl-15-(2,3,4,5,6-pentadeuteriophenyl)-1,15-diaza-8-boraheptacyclo[14.10.2.02,7.08,28.09,14.019,27.020,25]octacosa-2,4,6,9(14),10,12,16(28),17,19(27),20,22,24-dodecaen-26-one |
|---|---|
| PubChem CID | 169293259 |
| Molecular Formula | C35H27BN2O |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 11-tert-butyl-15-(2,3,4,5,6-pentadeuteriophenyl)-1,15-diaza-8-boraheptacyclo[14.10.2.02,7.08,28.09,14.019,27.020,25]octacosa-2,4,6,9(14),10,12,16(28),17,19(27),20,22,24-dodecaen-26-one |
| SMILES | [2H]c1c([2H])c([2H])c(N2c3ccc(C(C)(C)C)cc3B3c4ccccc4-n4c(=O)c5ccccc5c5ccc2c3c54)c([2H])c1[2H] |
| InChI | InChI=1S/C35H27BN2O/c1-35(2,3)22-17-19-30-28(21-22)36-27-15-9-10-16-29(27)38-33-25(24-13-7-8-14-26(24)34(38)39)18-20-31(32(33)36)37(30)23-11-5-4-6-12-23/h4-21H,1-3H3/i4D,5D,6D,11D,12D |
| InChIKey | BNAMNAPEFPUSGB-JTUJXQMYSA-N |
| XLogP | 6.05 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|