C39H35N3O — CID 170292891
5,11-ditert-butyl-15-phenyl-1,8,15-triazaheptacyclo[14.10.2.02,7.08,28.09,14.019,27.020,25]octacosa-2(7),3,5,9(14),10,12,16(28),17,19(27),20,22,24-dodecaen-26-one (PubChem CID 170292891) has the molecular formula C39H35N3O and a molecular weight of 561.73 g/mol. Its IUPAC name is 5,11-ditert-butyl-15-phenyl-1,8,15-triazaheptacyclo[14.10.2.02,7.08,28.09,14.019,27.020,25]octacosa-2(7),3,5,9(14),10,12,16(28),17,19(27),20,22,24-dodecaen-26-one.
| Compound Name | 5,11-ditert-butyl-15-phenyl-1,8,15-triazaheptacyclo[14.10.2.02,7.08,28.09,14.019,27.020,25]octacosa-2(7),3,5,9(14),10,12,16(28),17,19(27),20,22,24-dodecaen-26-one |
|---|---|
| PubChem CID | 170292891 |
| Molecular Formula | C39H35N3O |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 5,11-ditert-butyl-15-phenyl-1,8,15-triazaheptacyclo[14.10.2.02,7.08,28.09,14.019,27.020,25]octacosa-2(7),3,5,9(14),10,12,16(28),17,19(27),20,22,24-dodecaen-26-one |
| SMILES | CC(C)(C)c1ccc2c(c1)N1c3cc(C(C)(C)C)ccc3-n3c(=O)c4ccccc4c4ccc(c1c43)N2c1ccccc1 |
| InChI | InChI=1S/C39H35N3O/c1-38(2,3)24-16-19-30-33(22-24)41-34-23-25(39(4,5)6)17-20-31(34)42-35-28(27-14-10-11-15-29(27)37(42)43)18-21-32(36(35)41)40(30)26-12-8-7-9-13-26/h7-23H,1-6H3 |
| InChIKey | UMMXYCFQXHJLBN-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|