C13H20BFN5OS — CID 169299827
CID 169299827 (PubChem CID 169299827) has the molecular formula C13H20BFN5OS and a molecular weight of 324.21 g/mol.
| Compound Name | CID 169299827 |
|---|---|
| PubChem CID | 169299827 |
| Molecular Formula | C13H20BFN5OS |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | — |
| SMILES | C[B]ON1C2CCC1[C@H](F)[C@H](N(C)c1cnc(SC)nn1)C2 |
| InChI | InChI=1S/C13H20BFN5OS/c1-14-21-20-8-4-5-9(20)12(15)10(6-8)19(2)11-7-16-13(22-3)18-17-11/h7-10,12H,4-6H2,1-3H3/t8?,9?,10-,12+/m1/s1 |
| InChIKey | GGRGSVWIMCMQOA-PTFDWCFRSA-N |
| XLogP | 1.57 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|