C23H24FN5O5 — CID 174110225
(1S,2R,3R,5R)-2-fluoro-3-[[3-(6-methoxy-2-methyl-4-oxochromen-7-yl)-1,2,4-triazin-6-yl]-methylamino]-8-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 174110225) has the molecular formula C23H24FN5O5 and a molecular weight of 469.47 g/mol. Its IUPAC name is (1S,2R,3R,5R)-2-fluoro-3-[[3-(6-methoxy-2-methyl-4-oxochromen-7-yl)-1,2,4-triazin-6-yl]-methylamino]-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | (1S,2R,3R,5R)-2-fluoro-3-[[3-(6-methoxy-2-methyl-4-oxochromen-7-yl)-1,2,4-triazin-6-yl]-methylamino]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 174110225 |
| Molecular Formula | C23H24FN5O5 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (1S,2R,3R,5R)-2-fluoro-3-[[3-(6-methoxy-2-methyl-4-oxochromen-7-yl)-1,2,4-triazin-6-yl]-methylamino]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | COc1cc2c(=O)cc(C)oc2cc1-c1ncc(N(C)[C@@H]2C[C@H]3CC[C@@H]([C@@H]2F)N3C(=O)O)nn1 |
| InChI | InChI=1S/C23H24FN5O5/c1-11-6-17(30)13-8-18(33-3)14(9-19(13)34-11)22-25-10-20(26-27-22)28(2)16-7-12-4-5-15(21(16)24)29(12)23(31)32/h6,8-10,12,15-16,21H,4-5,7H2,1-3H3,(H,31,32)/t12-,15+,16-,21+/m1/s1 |
| InChIKey | RUCDNKWBSKQPDU-DDESSGNOSA-N |
| XLogP | 3.02 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |