C13H18FN5O2S — CID 170189288
(1S,2R,3R,5R)-2-fluoro-3-[methyl-(3-methylsulfanyl-1,2,4-triazin-6-yl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 170189288) has the molecular formula C13H18FN5O2S and a molecular weight of 327.39 g/mol. Its IUPAC name is (1S,2R,3R,5R)-2-fluoro-3-[methyl-(3-methylsulfanyl-1,2,4-triazin-6-yl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | (1S,2R,3R,5R)-2-fluoro-3-[methyl-(3-methylsulfanyl-1,2,4-triazin-6-yl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 170189288 |
| Molecular Formula | C13H18FN5O2S |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (1S,2R,3R,5R)-2-fluoro-3-[methyl-(3-methylsulfanyl-1,2,4-triazin-6-yl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | CSc1ncc(N(C)[C@@H]2C[C@H]3CC[C@@H]([C@@H]2F)N3C(=O)O)nn1 |
| InChI | InChI=1S/C13H18FN5O2S/c1-18(10-6-15-12(22-2)17-16-10)9-5-7-3-4-8(11(9)14)19(7)13(20)21/h6-9,11H,3-5H2,1-2H3,(H,20,21)/t7-,8+,9-,11+/m1/s1 |
| InChIKey | IWDCXOGPDRCJAY-LOKLDPHHSA-N |
| XLogP | 1.65 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |