C8H12F6 — CID 169301185
3-deuterio-1,1,1,5,5,5-hexafluoro-2,3,4-trimethylpentane (PubChem CID 169301185) has the molecular formula C8H12F6 and a molecular weight of 223.18 g/mol. Its IUPAC name is 3-deuterio-1,1,1,5,5,5-hexafluoro-2,3,4-trimethylpentane.
| Compound Name | 3-deuterio-1,1,1,5,5,5-hexafluoro-2,3,4-trimethylpentane |
|---|---|
| PubChem CID | 169301185 |
| Molecular Formula | C8H12F6 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 3-deuterio-1,1,1,5,5,5-hexafluoro-2,3,4-trimethylpentane |
| SMILES | [2H]C(C)(C(C)C(F)(F)F)C(C)C(F)(F)F |
| InChI | InChI=1S/C8H12F6/c1-4(5(2)7(9,10)11)6(3)8(12,13)14/h4-6H,1-3H3/i4D |
| InChIKey | GTOJSTRLUGFOCR-QYKNYGDISA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |