C4H5F4I — CID 23236245
(2R,3S)-1,1,1,3-tetrafluoro-3-iodo-2-methylpropane (PubChem CID 23236245) has the molecular formula C4H5F4I and a molecular weight of 255.98 g/mol. Its IUPAC name is (2R,3S)-1,1,1,3-tetrafluoro-3-iodo-2-methylpropane.
| Compound Name | (2R,3S)-1,1,1,3-tetrafluoro-3-iodo-2-methylpropane |
|---|---|
| PubChem CID | 23236245 |
| Molecular Formula | C4H5F4I |
| Molecular Weight | 255.98 g/mol |
| Exact Mass | 255.94 |
| IUPAC Name | (2R,3S)-1,1,1,3-tetrafluoro-3-iodo-2-methylpropane |
| SMILES | C[C@@H]([C@@H](F)I)C(F)(F)F |
| InChI | InChI=1S/C4H5F4I/c1-2(3(5)9)4(6,7)8/h2-3H,1H3/t2-,3-/m0/s1 |
| InChIKey | JVVVSVGPAPZIQS-HRFVKAFMSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.98 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|