C46H37F4IrN3S-2 — CID 169301247
1-(2,6-dimethylphenyl)-2-(4-fluorobenzene-6-id-1-yl)benzimidazole;iridium;3-methyl-7-phenyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine (PubChem CID 169301247) has the molecular formula C46H37F4IrN3S-2 and a molecular weight of 932.10 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2-(4-fluorobenzene-6-id-1-yl)benzimidazole;iridium;3-methyl-7-phenyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine.
| Compound Name | 1-(2,6-dimethylphenyl)-2-(4-fluorobenzene-6-id-1-yl)benzimidazole;iridium;3-methyl-7-phenyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 169301247 |
| Molecular Formula | C46H37F4IrN3S-2 |
| Molecular Weight | 932.10 g/mol |
| Exact Mass | 932.23 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2-(4-fluorobenzene-6-id-1-yl)benzimidazole;iridium;3-methyl-7-phenyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine |
| SMILES | Cc1c(-c2ccc(CC(C)(C)C(F)(F)F)cc2)sc2c(-c3[c-]cccc3)nccc12.Cc1cccc(C)c1-n1c(-c2[c-]cc(F)cc2)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C25H21F3NS.C21H16FN2.Ir/c1-16-20-13-14-29-21(18-7-5-4-6-8-18)23(20)30-22(16)19-11-9-17(10-12-19)15-24(2,3)25(26,27)28;1-14-6-5-7-15(2)20(14)24-19-9-4-3-8-18(19)23-21(24)16-10-12-17(22)13-11-16;/h4-7,9-14H,15H2,1-3H3;3-10,12-13H,1-2H3;/q2*-1; |
| InChIKey | FZHZCQWWZBHWAM-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.10 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|