C27H39NO3 — CID 169311871
(3S,8S,9S,10R,13S,14S,17S)-17-[(1S)-1-[[6-(hydroxymethyl)-3-pyridinyl]oxy]ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169311871) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-[(1S)-1-[[6-(hydroxymethyl)-3-pyridinyl]oxy]ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(1S)-1-[[6-(hydroxymethyl)-3-pyridinyl]oxy]ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169311871 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(1S)-1-[[6-(hydroxymethyl)-3-pyridinyl]oxy]ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](Oc1ccc(CO)nc1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H39NO3/c1-17(31-21-6-5-19(16-29)28-15-21)23-8-9-24-22-7-4-18-14-20(30)10-12-26(18,2)25(22)11-13-27(23,24)3/h4-6,15,17,20,22-25,29-30H,7-14,16H2,1-3H3/t17-,20-,22-,23+,24-,25-,26-,27+/m0/s1 |
| InChIKey | FLEQWASKRYTXSA-JYHREAJASA-N |
| XLogP | 5.28 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|