C27H39NO2 — CID 170306577
(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[1-[(4-methyl-3-pyridinyl)oxy]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 170306577) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[1-[(4-methyl-3-pyridinyl)oxy]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[1-[(4-methyl-3-pyridinyl)oxy]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 170306577 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[1-[(4-methyl-3-pyridinyl)oxy]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | Cc1ccncc1OC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H39NO2/c1-17-11-14-28-16-25(17)30-18(2)22-7-8-23-21-6-5-19-15-20(29)9-12-26(19,3)24(21)10-13-27(22,23)4/h5,11,14,16,18,20-24,29H,6-10,12-13,15H2,1-4H3/t18?,20-,21-,22+,23-,24-,26-,27+/m0/s1 |
| InChIKey | ZGHRTWAFNHVPSM-RUYHLHGNSA-N |
| XLogP | 6.10 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|