C28H41NO3 — CID 169312013
[5-[(1S)-1-[(1S,2R,5R,10S,11S,14S,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]ethoxy]-3-pyridinyl]methanol (PubChem CID 169312013) has the molecular formula C28H41NO3 and a molecular weight of 439.64 g/mol. Its IUPAC name is [5-[(1S)-1-[(1S,2R,5R,10S,11S,14S,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]ethoxy]-3-pyridinyl]methanol.
| Compound Name | [5-[(1S)-1-[(1S,2R,5R,10S,11S,14S,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]ethoxy]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 169312013 |
| Molecular Formula | C28H41NO3 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | [5-[(1S)-1-[(1S,2R,5R,10S,11S,14S,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]ethoxy]-3-pyridinyl]methanol |
| SMILES | COC1C[C@H]2[C@@H]3CC[C@H]([C@H](C)Oc4cncc(CO)c4)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3CC132 |
| InChI | InChI=1S/C28H41NO3/c1-17(32-20-11-18(16-30)14-29-15-20)22-5-6-23-21-12-25(31-4)28-13-19(28)7-10-27(28,3)24(21)8-9-26(22,23)2/h11,14-15,17,19,21-25,30H,5-10,12-13,16H2,1-4H3/t17-,19+,21-,22+,23-,24-,25?,26+,27+,28?/m0/s1 |
| InChIKey | BYJOXJWTCWUOIZ-ZYCAGJGSSA-N |
| XLogP | 5.62 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |