C25H40O2 — CID 20831048
(E,4R)-4-[(1S,2R,5S,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pent-2-en-1-ol (PubChem CID 20831048) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (E,4R)-4-[(1S,2R,5S,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pent-2-en-1-ol.
| Compound Name | (E,4R)-4-[(1S,2R,5S,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 20831048 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (E,4R)-4-[(1S,2R,5S,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pent-2-en-1-ol |
| SMILES | CO[C@@H]1C[C@H]2[C@@H]3CC[C@H]([C@H](C)/C=C/CO)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@H]3CC312 |
| InChI | InChI=1S/C25H40O2/c1-16(6-5-13-26)19-7-8-20-18-14-22(27-4)25-15-17(25)9-12-24(25,3)21(18)10-11-23(19,20)2/h5-6,16-22,26H,7-15H2,1-4H3/b6-5+/t16-,17+,18+,19-,20+,21+,22-,23-,24-,25?/m1/s1 |
| InChIKey | FEDKYGJROLMZTK-SOTWSMFESA-N |
| XLogP | 5.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|