C34H58O — CID 101027069
(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-[(E,2R)-tetradec-3-en-2-yl]pentacyclo[8.7.0.02,7.05,7.011,15]heptadecane (PubChem CID 101027069) has the molecular formula C34H58O and a molecular weight of 482.84 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-[(E,2R)-tetradec-3-en-2-yl]pentacyclo[8.7.0.02,7.05,7.011,15]heptadecane.
| Compound Name | (1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-[(E,2R)-tetradec-3-en-2-yl]pentacyclo[8.7.0.02,7.05,7.011,15]heptadecane |
|---|---|
| PubChem CID | 101027069 |
| Molecular Formula | C34H58O |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 482.45 |
| IUPAC Name | (1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-[(E,2R)-tetradec-3-en-2-yl]pentacyclo[8.7.0.02,7.05,7.011,15]heptadecane |
| SMILES | CCCCCCCCCC/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](OC)[C@]45C[C@H]4CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H58O/c1-6-7-8-9-10-11-12-13-14-15-16-25(2)28-17-18-29-27-23-31(35-5)34-24-26(34)19-22-33(34,4)30(27)20-21-32(28,29)3/h15-16,25-31H,6-14,17-24H2,1-5H3/b16-15+/t25-,26-,27+,28-,29+,30+,31-,32-,33-,34+/m1/s1 |
| InChIKey | MZAIDYIWQILDGW-QYLJHOEZSA-N |
| XLogP | 9.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|