C30H49BO3 — CID 169312055
2-[(E,3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 169312055) has the molecular formula C30H49BO3 and a molecular weight of 468.53 g/mol. Its IUPAC name is 2-[(E,3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E,3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 169312055 |
| Molecular Formula | C30H49BO3 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.38 |
| IUPAC Name | 2-[(E,3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COC1C[C@H]2[C@@H]3CC[C@H]([C@H](C)/C=C/B4OC(C)(C)C(C)(C)O4)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3CC132 |
| InChI | InChI=1S/C30H49BO3/c1-19(13-16-31-33-26(2,3)27(4,5)34-31)22-9-10-23-21-17-25(32-8)30-18-20(30)11-15-29(30,7)24(21)12-14-28(22,23)6/h13,16,19-25H,9-12,14-15,17-18H2,1-8H3/b16-13+/t19-,20-,21+,22-,23+,24+,25?,28-,29-,30?/m1/s1 |
| InChIKey | ZDCBRBBDALMGAT-ORJAJKJWSA-N |
| XLogP | 7.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|