C32H54O3Si — CID 102461254
trimethylsilyl (E,3R,6R)-6-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2,3-dimethylhept-4-enoate (PubChem CID 102461254) has the molecular formula C32H54O3Si and a molecular weight of 514.87 g/mol. Its IUPAC name is trimethylsilyl (E,3R,6R)-6-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2,3-dimethylhept-4-enoate.
| Compound Name | trimethylsilyl (E,3R,6R)-6-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2,3-dimethylhept-4-enoate |
|---|---|
| PubChem CID | 102461254 |
| Molecular Formula | C32H54O3Si |
| Molecular Weight | 514.87 g/mol |
| Exact Mass | 514.38 |
| IUPAC Name | trimethylsilyl (E,3R,6R)-6-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2,3-dimethylhept-4-enoate |
| SMILES | CO[C@@H]1C[C@H]2[C@@H]3CC[C@H]([C@H](C)/C=C/[C@@H](C)C(C)C(=O)O[Si](C)(C)C)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3C[C@]312 |
| InChI | InChI=1S/C32H54O3Si/c1-20(22(3)29(33)35-36(7,8)9)10-11-21(2)25-12-13-26-24-18-28(34-6)32-19-23(32)14-17-31(32,5)27(24)15-16-30(25,26)4/h10-11,20-28H,12-19H2,1-9H3/b11-10+/t20-,21-,22?,23-,24+,25-,26+,27+,28-,30-,31-,32+/m1/s1 |
| InChIKey | YYOYDLLDVRFLHX-HRNHNXOZSA-N |
| XLogP | 8.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.87 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|