C28H44O3 — CID 23583065
(E,2S,6R)-6-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2-methylhept-4-enoic acid (PubChem CID 23583065) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is (E,2S,6R)-6-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2-methylhept-4-enoic acid.
| Compound Name | (E,2S,6R)-6-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2-methylhept-4-enoic acid |
|---|---|
| PubChem CID | 23583065 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (E,2S,6R)-6-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2-methylhept-4-enoic acid |
| SMILES | CO[C@@H]1C[C@H]2[C@@H]3CC[C@H]([C@H](C)/C=C/C[C@H](C)C(=O)O)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3C[C@]312 |
| InChI | InChI=1S/C28H44O3/c1-17(7-6-8-18(2)25(29)30)21-9-10-22-20-15-24(31-5)28-16-19(28)11-14-27(28,4)23(20)12-13-26(21,22)3/h6-7,17-24H,8-16H2,1-5H3,(H,29,30)/b7-6+/t17-,18+,19-,20+,21-,22+,23+,24-,26-,27-,28+/m1/s1 |
| InChIKey | LKFQHALRSXGIIC-RRSQTIBNSA-N |
| XLogP | 6.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|