C29H49NO3 — CID 169312408
N-butyl-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxypentanamide (PubChem CID 169312408) has the molecular formula C29H49NO3 and a molecular weight of 459.72 g/mol. Its IUPAC name is N-butyl-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxypentanamide.
| Compound Name | N-butyl-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxypentanamide |
|---|---|
| PubChem CID | 169312408 |
| Molecular Formula | C29H49NO3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | N-butyl-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxypentanamide |
| SMILES | CCCCN(OC)C(=O)CCC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H49NO3/c1-6-7-18-30(33-5)27(32)13-8-20(2)24-11-12-25-23-10-9-21-19-22(31)14-16-28(21,3)26(23)15-17-29(24,25)4/h9,20,22-26,31H,6-8,10-19H2,1-5H3/t20?,22-,23-,24+,25-,26-,28-,29+/m0/s1 |
| InChIKey | DERUBASVYKDRBY-GNEYARJESA-N |
| XLogP | 6.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|