C29H47NO3 — CID 169312811
(4R)-N-(cyclopropylmethyl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxypentanamide (PubChem CID 169312811) has the molecular formula C29H47NO3 and a molecular weight of 457.70 g/mol. Its IUPAC name is (4R)-N-(cyclopropylmethyl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxypentanamide.
| Compound Name | (4R)-N-(cyclopropylmethyl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxypentanamide |
|---|---|
| PubChem CID | 169312811 |
| Molecular Formula | C29H47NO3 |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.36 |
| IUPAC Name | (4R)-N-(cyclopropylmethyl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-methoxypentanamide |
| SMILES | CON(CC1CC1)C(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H47NO3/c1-19(5-12-27(32)30(33-4)18-20-6-7-20)24-10-11-25-23-9-8-21-17-22(31)13-15-28(21,2)26(23)14-16-29(24,25)3/h8,19-20,22-26,31H,5-7,9-18H2,1-4H3/t19-,22+,23+,24-,25+,26+,28+,29-/m1/s1 |
| InChIKey | HBDLXFHCMFMYCB-HSIBUNQISA-N |
| XLogP | 6.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|