C27H43NO5 — CID 170305947
2-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl-methoxyamino]acetic acid (PubChem CID 170305947) has the molecular formula C27H43NO5 and a molecular weight of 461.64 g/mol. Its IUPAC name is 2-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl-methoxyamino]acetic acid.
| Compound Name | 2-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl-methoxyamino]acetic acid |
|---|---|
| PubChem CID | 170305947 |
| Molecular Formula | C27H43NO5 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.31 |
| IUPAC Name | 2-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl-methoxyamino]acetic acid |
| SMILES | CON(CC(=O)O)C(=O)CCC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H43NO5/c1-17(5-10-24(30)28(33-4)16-25(31)32)21-8-9-22-20-7-6-18-15-19(29)11-13-26(18,2)23(20)12-14-27(21,22)3/h6,17,19-23,29H,5,7-16H2,1-4H3,(H,31,32)/t17?,19-,20-,21+,22-,23-,26-,27+/m0/s1 |
| InChIKey | HDQCGBHRYNQICK-GUHWDSOESA-N |
| XLogP | 4.82 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|