C27H43NO4 — CID 169312826
[(1S)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] 2-(diethylamino)-2-oxoacetate (PubChem CID 169312826) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is [(1S)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] 2-(diethylamino)-2-oxoacetate.
| Compound Name | [(1S)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] 2-(diethylamino)-2-oxoacetate |
|---|---|
| PubChem CID | 169312826 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | [(1S)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] 2-(diethylamino)-2-oxoacetate |
| SMILES | CCN(CC)C(=O)C(=O)O[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H43NO4/c1-6-28(7-2)24(30)25(31)32-17(3)21-10-11-22-20-9-8-18-16-19(29)12-14-26(18,4)23(20)13-15-27(21,22)5/h8,17,19-23,29H,6-7,9-16H2,1-5H3/t17-,19-,20-,21+,22-,23-,26-,27+/m0/s1 |
| InChIKey | NIOWYZWIYTYWKD-GSXUXVAXSA-N |
| XLogP | 4.73 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|