C26H39NO4 — CID 170306267
1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2-(azetidin-1-yl)-2-oxoacetate (PubChem CID 170306267) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is 1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2-(azetidin-1-yl)-2-oxoacetate.
| Compound Name | 1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2-(azetidin-1-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 170306267 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | 1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2-(azetidin-1-yl)-2-oxoacetate |
| SMILES | CC(OC(=O)C(=O)N1CCC1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H39NO4/c1-16(31-24(30)23(29)27-13-4-14-27)20-7-8-21-19-6-5-17-15-18(28)9-11-25(17,2)22(19)10-12-26(20,21)3/h5,16,18-22,28H,4,6-15H2,1-3H3/t16?,18-,19-,20+,21-,22-,25-,26+/m0/s1 |
| InChIKey | RCTFTKXXLWHCMF-BRSHZPLFSA-N |
| XLogP | 4.09 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|