C26H41NO3 — CID 588877
2-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-1-morpholin-4-ylpropan-1-one (PubChem CID 588877) has the molecular formula C26H41NO3 and a molecular weight of 415.62 g/mol. Its IUPAC name is 2-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-1-morpholin-4-ylpropan-1-one.
| Compound Name | 2-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 588877 |
| Molecular Formula | C26H41NO3 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | 2-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-1-morpholin-4-ylpropan-1-one |
| SMILES | CC(C(=O)N1CCOCC1)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H41NO3/c1-17(24(29)27-12-14-30-15-13-27)21-6-7-22-20-5-4-18-16-19(28)8-10-25(18,2)23(20)9-11-26(21,22)3/h4,17,19-23,28H,5-16H2,1-3H3 |
| InChIKey | XNBYGHRPGCDZOC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|