C14H16N5O6P — CID 169313018
(2R,4aR,6R,7R,7aS)-6-(4-amino-5-deuteriopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethoxy-7-hydroxy-2-oxo-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinine-6-carbonitrile (PubChem CID 169313018) has the molecular formula C14H16N5O6P and a molecular weight of 382.29 g/mol. Its IUPAC name is (2R,4aR,6R,7R,7aS)-6-(4-amino-5-deuteriopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethoxy-7-hydroxy-2-oxo-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinine-6-carbonitrile.
| Compound Name | (2R,4aR,6R,7R,7aS)-6-(4-amino-5-deuteriopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethoxy-7-hydroxy-2-oxo-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinine-6-carbonitrile |
|---|---|
| PubChem CID | 169313018 |
| Molecular Formula | C14H16N5O6P |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (2R,4aR,6R,7R,7aS)-6-(4-amino-5-deuteriopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethoxy-7-hydroxy-2-oxo-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinine-6-carbonitrile |
| SMILES | [2H]c1cc([C@]2(C#N)O[C@@H]3CO[P@@](=O)(OCC)O[C@H]3[C@H]2O)n2ncnc(N)c12 |
| InChI | InChI=1S/C14H16N5O6P/c1-2-22-26(21)23-5-9-11(25-26)12(20)14(6-15,24-9)10-4-3-8-13(16)17-7-18-19(8)10/h3-4,7,9,11-12,20H,2,5H2,1H3,(H2,16,17,18)/t9-,11-,12-,14+,26-/m1/s1/i3D |
| InChIKey | IJMUFKGSNLMCNZ-SUGFHHSJSA-N |
| XLogP | 0.35 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|