C20H18N5O9P — CID 169313071
[(2R,4aR,6R,7R,7aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-cyano-7-hydroxy-2-oxo-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxymethyl phenyl carbonate (PubChem CID 169313071) has the molecular formula C20H18N5O9P and a molecular weight of 503.36 g/mol. Its IUPAC name is [(2R,4aR,6R,7R,7aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-cyano-7-hydroxy-2-oxo-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxymethyl phenyl carbonate.
| Compound Name | [(2R,4aR,6R,7R,7aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-cyano-7-hydroxy-2-oxo-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxymethyl phenyl carbonate |
|---|---|
| PubChem CID | 169313071 |
| Molecular Formula | C20H18N5O9P |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | [(2R,4aR,6R,7R,7aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-cyano-7-hydroxy-2-oxo-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxymethyl phenyl carbonate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@@H]2CO[P@@](=O)(OCOC(=O)Oc3ccccc3)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C20H18N5O9P/c21-9-20(15-7-6-13-18(22)23-10-24-25(13)15)17(26)16-14(33-20)8-30-35(28,34-16)31-11-29-19(27)32-12-4-2-1-3-5-12/h1-7,10,14,16-17,26H,8,11H2,(H2,22,23,24)/t14-,16-,17-,20+,35+/m1/s1 |
| InChIKey | HGRDGJDASBXBLR-XGBCTMGXSA-N |
| XLogP | 1.50 |
| TPSA | 189.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|