C32H6F10N4O3S3 — CID 169314146
[5-[7-[2-(2,3,4,5,6-pentafluorobenzoyl)-1,3-thiazol-5-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzoxazol-2-yl]-1,3-thiazol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 169314146) has the molecular formula C32H6F10N4O3S3 and a molecular weight of 780.61 g/mol. Its IUPAC name is [5-[7-[2-(2,3,4,5,6-pentafluorobenzoyl)-1,3-thiazol-5-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzoxazol-2-yl]-1,3-thiazol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [5-[7-[2-(2,3,4,5,6-pentafluorobenzoyl)-1,3-thiazol-5-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzoxazol-2-yl]-1,3-thiazol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 169314146 |
| Molecular Formula | C32H6F10N4O3S3 |
| Molecular Weight | 780.61 g/mol |
| Exact Mass | 779.94 |
| IUPAC Name | [5-[7-[2-(2,3,4,5,6-pentafluorobenzoyl)-1,3-thiazol-5-yl]-[1,3]benzothiazolo[6,5-f][1,3]benzoxazol-2-yl]-1,3-thiazol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(c1ncc(-c2nc3cc4cc5sc(-c6cnc(C(=O)c7c(F)c(F)c(F)c(F)c7F)s6)nc5cc4cc3o2)s1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C32H6F10N4O3S3/c33-17-15(18(34)22(38)25(41)21(17)37)27(47)31-43-5-13(51-31)29-45-9-1-8-4-12-10(2-7(8)3-11(9)49-29)46-30(50-12)14-6-44-32(52-14)28(48)16-19(35)23(39)26(42)24(40)20(16)36/h1-6H |
| InChIKey | NATUMJCNMPJQSG-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 98.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.61 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|