C30H19NOS — CID 169315792
N-dibenzothiophen-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-amine (PubChem CID 169315792) has the molecular formula C30H19NOS and a molecular weight of 446.59 g/mol. Its IUPAC name is N-dibenzothiophen-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-amine.
| Compound Name | N-dibenzothiophen-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-amine |
|---|---|
| PubChem CID | 169315792 |
| Molecular Formula | C30H19NOS |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-dibenzothiophen-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3oc4ccc(Nc5ccc6c(c5)sc5ccccc56)cc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C30H19NOS/c1-2-7-19(8-3-1)22-10-6-11-27-30(22)25-17-20(14-16-26(25)32-27)31-21-13-15-24-23-9-4-5-12-28(23)33-29(24)18-21/h1-18,31H/i1D,2D,3D,7D,8D |
| InChIKey | PVSSXHLSIIAYNA-RCQSQLKUSA-N |
| XLogP | 9.36 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |