C12H19N3OS — CID 169318655
1-[(3R)-3-isocyano-1-thia-4,7-diazaspiro[4.4]nonan-7-yl]-2,2-dimethylpropan-1-one (PubChem CID 169318655) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-[(3R)-3-isocyano-1-thia-4,7-diazaspiro[4.4]nonan-7-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(3R)-3-isocyano-1-thia-4,7-diazaspiro[4.4]nonan-7-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 169318655 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-[(3R)-3-isocyano-1-thia-4,7-diazaspiro[4.4]nonan-7-yl]-2,2-dimethylpropan-1-one |
| SMILES | [C-]#[N+][C@@H]1CSC2(CCN(C(=O)C(C)(C)C)C2)N1 |
| InChI | InChI=1S/C12H19N3OS/c1-11(2,3)10(16)15-6-5-12(8-15)14-9(13-4)7-17-12/h9,14H,5-8H2,1-3H3/t9-,12?/m0/s1 |
| InChIKey | BXLUOQBCKBKZGN-QHGLUPRGSA-N |
| XLogP | 1.54 |
| TPSA | 36.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|