About 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate
1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate (PubChem CID 169321766) has the molecular formula C24H33FO8
and a molecular weight of 468.52 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate |
| PubChem CID | 169321766 |
| Molecular Formula | C24H33FO8 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate |
| SMILES | COC(=O)c1cc(OC2CCC(C(=O)OC)(C(=O)OC(C)(C)C)CC2)c(F)cc1OC(C)C |
| InChI | InChI=1S/C24H33FO8/c1-14(2)31-18-13-17(25)19(12-16(18)20(26)29-6)32-15-8-10-24(11-9-15,21(27)30-7)22(28)33-23(3,4)5/h12-15H,8-11H2,1-7H3 |
| InChIKey | VRYJHOIWNZHUHI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate?
The IUPAC name of 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate (CID 169321766) is 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate.
What is the SMILES notation for 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate?
The canonical SMILES for 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate is COC(=O)c1cc(OC2CCC(C(=O)OC)(C(=O)OC(C)(C)C)CC2)c(F)cc1OC(C)C.
What is the InChIKey of 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate?
The InChIKey is VRYJHOIWNZHUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33FO8/c1-14(2)31-18-13-17(25)19(12-16(18)20(26)29-6)32-15-8-10-24(11-9-15,21(27)30-7)22(28)33-23(3,4)5/h12-15H,8-11H2,1-7H3.
What are the key properties of 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate?
1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate has a molecular weight of 468.52 g/mol, XLogP of 4.22, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate is sourced from PubChem (CID 169321766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).