C24H33FO8 — CID 169321766
1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate (PubChem CID 169321766) has the molecular formula C24H33FO8 and a molecular weight of 468.52 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 169321766 |
| Molecular Formula | C24H33FO8 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 1-O'-tert-butyl 1-O-methyl 4-(2-fluoro-5-methoxycarbonyl-4-propan-2-yloxyphenoxy)cyclohexane-1,1-dicarboxylate |
| SMILES | COC(=O)c1cc(OC2CCC(C(=O)OC)(C(=O)OC(C)(C)C)CC2)c(F)cc1OC(C)C |
| InChI | InChI=1S/C24H33FO8/c1-14(2)31-18-13-17(25)19(12-16(18)20(26)29-6)32-15-8-10-24(11-9-15,21(27)30-7)22(28)33-23(3,4)5/h12-15H,8-11H2,1-7H3 |
| InChIKey | VRYJHOIWNZHUHI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|