C20H25F3N2O3Si — CID 169322761
phenyl N-[6-[1-[tert-butyl(dimethyl)silyl]oxy-2,2,2-trifluoroethyl]-3-pyridinyl]carbamate (PubChem CID 169322761) has the molecular formula C20H25F3N2O3Si and a molecular weight of 426.51 g/mol. Its IUPAC name is phenyl N-[6-[1-[tert-butyl(dimethyl)silyl]oxy-2,2,2-trifluoroethyl]-3-pyridinyl]carbamate.
| Compound Name | phenyl N-[6-[1-[tert-butyl(dimethyl)silyl]oxy-2,2,2-trifluoroethyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 169322761 |
| Molecular Formula | C20H25F3N2O3Si |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | phenyl N-[6-[1-[tert-butyl(dimethyl)silyl]oxy-2,2,2-trifluoroethyl]-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC(c1ccc(NC(=O)Oc2ccccc2)cn1)C(F)(F)F |
| InChI | InChI=1S/C20H25F3N2O3Si/c1-19(2,3)29(4,5)28-17(20(21,22)23)16-12-11-14(13-24-16)25-18(26)27-15-9-7-6-8-10-15/h6-13,17H,1-5H3,(H,25,26) |
| InChIKey | KCPUHPSSZWBXMQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|