C30H30Cl4N2O6 — CID 169323821
ethyl 2-[3,5-dichloro-4-[(E)-6-[2,6-dichloro-4-(3-methoxy-3-oxopropyl)phenoxy]hex-3-enoxy]anilino]pyridine-3-carboxylate (PubChem CID 169323821) has the molecular formula C30H30Cl4N2O6 and a molecular weight of 656.39 g/mol. Its IUPAC name is ethyl 2-[3,5-dichloro-4-[(E)-6-[2,6-dichloro-4-(3-methoxy-3-oxopropyl)phenoxy]hex-3-enoxy]anilino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[3,5-dichloro-4-[(E)-6-[2,6-dichloro-4-(3-methoxy-3-oxopropyl)phenoxy]hex-3-enoxy]anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 169323821 |
| Molecular Formula | C30H30Cl4N2O6 |
| Molecular Weight | 656.39 g/mol |
| Exact Mass | 654.09 |
| IUPAC Name | ethyl 2-[3,5-dichloro-4-[(E)-6-[2,6-dichloro-4-(3-methoxy-3-oxopropyl)phenoxy]hex-3-enoxy]anilino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1Nc1cc(Cl)c(OCC/C=C/CCOc2c(Cl)cc(CCC(=O)OC)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H30Cl4N2O6/c1-3-40-30(38)21-9-8-12-35-29(21)36-20-17-24(33)28(25(34)18-20)42-14-7-5-4-6-13-41-27-22(31)15-19(16-23(27)32)10-11-26(37)39-2/h4-5,8-9,12,15-18H,3,6-7,10-11,13-14H2,1-2H3,(H,35,36)/b5-4+ |
| InChIKey | MAYPYVYBKJBZTA-SNAWJCMRSA-N |
| XLogP | 8.52 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.39 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|