C13H17NO7S — CID 169324279
(2S)-2-hydroxy-3,4-dimethyl-2-(4-nitrophenyl)sulfonylpentanoic acid (PubChem CID 169324279) has the molecular formula C13H17NO7S and a molecular weight of 331.35 g/mol. Its IUPAC name is (2S)-2-hydroxy-3,4-dimethyl-2-(4-nitrophenyl)sulfonylpentanoic acid.
| Compound Name | (2S)-2-hydroxy-3,4-dimethyl-2-(4-nitrophenyl)sulfonylpentanoic acid |
|---|---|
| PubChem CID | 169324279 |
| Molecular Formula | C13H17NO7S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (2S)-2-hydroxy-3,4-dimethyl-2-(4-nitrophenyl)sulfonylpentanoic acid |
| SMILES | CC(C)C(C)[C@@](O)(C(=O)O)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17NO7S/c1-8(2)9(3)13(17,12(15)16)22(20,21)11-6-4-10(5-7-11)14(18)19/h4-9,17H,1-3H3,(H,15,16)/t9?,13-/m0/s1 |
| InChIKey | HAPHSMZBHHZILE-NCWAPJAISA-N |
| XLogP | 1.43 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|