C21H18N6O3 — CID 169328860
4-amino-5-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328860) has the molecular formula C21H18N6O3 and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-amino-5-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328860 |
| Molecular Formula | C21H18N6O3 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 4-amino-5-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(-n3c(N)c4c(cc3=O)C(=O)NC4=O)cc2)cc1 |
| InChI | InChI=1S/C21H18N6O3/c1-26(2)14-7-3-12(4-8-14)24-25-13-5-9-15(10-6-13)27-17(28)11-16-18(19(27)22)21(30)23-20(16)29/h3-11H,22H2,1-2H3,(H,23,29,30)/b25-24+ |
| InChIKey | JGQURZWAGMLIME-OCOZRVBESA-N |
| XLogP | 2.78 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|