C23H27N5O4 — CID 169329503
4-amino-5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329503) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 4-amino-5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329503 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 4-amino-5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methoxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | COc1cc(N2CCC3(CCNCC3)CC2)ccc1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C23H27N5O4/c1-32-17-12-14(27-10-6-23(7-11-27)4-8-25-9-5-23)2-3-16(17)28-18(29)13-15-19(20(28)24)22(31)26-21(15)30/h2-3,12-13,25H,4-11,24H2,1H3,(H,26,30,31) |
| InChIKey | MVQQMFZIZDFDDI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|